Difference between revisions of "PWYG-321"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1099 CPD-1099] == * common-name: ** raffinose * smiles: ** c(oc1(c(c(c(c(co)o1)o)o)o))c2(c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-tauphospho-L-histidines Protein-tauphospho-L-histidines] == * common-name: ** a [protei...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1099 CPD-1099] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-tauphospho-L-histidines Protein-tauphospho-L-histidines] ==
 
* common-name:
 
* common-name:
** raffinose
+
** a [protein]-nτ-phospho-l-histidine
* smiles:
 
** c(oc1(c(c(c(c(co)o1)o)o)o))c2(c(c(c(c(o2)oc3(co)(c(c(c(co)o3)o)o))o)o)o)
 
* inchi-key:
 
** mupfekgtmrgplj-zqskzdjdsa-n
 
* molecular-weight:
 
** 504.441
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.67-RXN]]
+
* [[RXN-17132]]
* [[RXN-11502]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.4.1.67-RXN]]
 
* [[2.4.1.82-RXN]]
 
* [[RXN-11501]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=raffinose}}
+
{{#set: common-name=a [protein]-nτ-phospho-l-histidine}}
{{#set: inchi-key=inchikey=mupfekgtmrgplj-zqskzdjdsa-n}}
 
{{#set: molecular-weight=504.441}}
 

Revision as of 09:22, 27 August 2019

Metabolite Protein-tauphospho-L-histidines

  • common-name:
    • a [protein]-nτ-phospho-l-histidine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-nτ-phospho-l-histidine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.