Difference between revisions of "PWYQT-4429"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] == * common-name: ** 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol *...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNOSINE CARNOSINE] == * common-name: ** carnosine * smiles: ** c(cc(=o)nc(cc1(=cnc=n1))c([o-]...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNOSINE CARNOSINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** carnosine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(cc(=o)nc(cc1(=cnc=n1))c([o-])=o)[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cqovpnpjlqnmdc-zetcqymhsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 226.235 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[CARNOSINE-N-METHYLTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=carnosine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cqovpnpjlqnmdc-zetcqymhsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=226.235}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CARNOSINE
- common-name:
- carnosine
- smiles:
- c(cc(=o)nc(cc1(=cnc=n1))c([o-])=o)[n+]
- inchi-key:
- cqovpnpjlqnmdc-zetcqymhsa-n
- molecular-weight:
- 226.235
