Difference between revisions of "PWYQT-4476"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate * smil...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pyruvate-dehydrogenase-L-serine Pyruvate-dehydrogenase-L-serine] == * common-name: ** a [pyruva...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pyruvate-dehydrogenase-L-serine Pyruvate-dehydrogenase-L-serine] ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate
+
** a [pyruvate dehydrogenase e1 α subunit]-l-serine
* smiles:
 
** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o)
 
* inchi-key:
 
** bzxzfdkirzbjep-jmtmcxqrsa-m
 
* molecular-weight:
 
** 293.425
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.7.11.2-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]]
+
* [[3.1.3.43-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate}}
+
{{#set: common-name=a [pyruvate dehydrogenase e1 α subunit]-l-serine}}
{{#set: inchi-key=inchikey=bzxzfdkirzbjep-jmtmcxqrsa-m}}
 
{{#set: molecular-weight=293.425}}
 

Revision as of 14:19, 26 August 2019

Metabolite Pyruvate-dehydrogenase-L-serine

  • common-name:
    • a [pyruvate dehydrogenase e1 α subunit]-l-serine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [pyruvate dehydrogenase e1 α subunit]-l-serine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.