Difference between revisions of "PYRAZINAMIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11404 == * common-name: ** 3,3',5-triiodothyroacetate * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c=c2)) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite Nucleosides == * common-name: ** a nucleoside == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compoun...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Nucleosides == |
* common-name: | * common-name: | ||
− | ** | + | ** a nucleoside |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[NUCLEOTIDASE-RXN]] | ||
+ | * [[RXN-14473]] | ||
+ | * [[RXN-17947]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a nucleoside}} |
− | |||
− |
Revision as of 18:58, 14 January 2021
Contents
Metabolite Nucleosides
- common-name:
- a nucleoside