Difference between revisions of "PYRAZINOIC-ACID"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5923 == * common-name: ** 5'-deoxy-5'-fluoroadenosine * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))f * inchi-key: ** qp...") |
(Created page with "Category:metabolite == Metabolite PYRAZINOIC-ACID == * common-name: ** pyrazine-2-carboxylate * smiles: ** c1(n=cc=nc=1c([o-])=o) * inchi-key: ** nipzzxufjpqhnh-uhfffaoysa...") |
||
(5 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PYRAZINOIC-ACID == |
* common-name: | * common-name: | ||
− | ** | + | ** pyrazine-2-carboxylate |
* smiles: | * smiles: | ||
− | ** | + | ** c1(n=cc=nc=1c([o-])=o) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** nipzzxufjpqhnh-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 123.091 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[PYRAZIN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=pyrazine-2-carboxylate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nipzzxufjpqhnh-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=123.091}} |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite PYRAZINOIC-ACID
- common-name:
- pyrazine-2-carboxylate
- smiles:
- c1(n=cc=nc=1c([o-])=o)
- inchi-key:
- nipzzxufjpqhnh-uhfffaoysa-m
- molecular-weight:
- 123.091