Difference between revisions of "PYRIDNUCSYN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] == * common-name: ** 5-chloro-5-deoxy-d-ribonate * smiles: ** c(=o)([o-])c...")
(Created page with "Category:pathway == Pathway PYRIDNUCSYN-PWY == * taxonomic-range: ** tax-2759 ** tax-2 * common-name: ** nad biosynthesis i (from aspartate) == Reaction(s) found == * L-...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] ==
+
== Pathway PYRIDNUCSYN-PWY ==
 +
* taxonomic-range:
 +
** tax-2759
 +
** tax-2
 
* common-name:
 
* common-name:
** 5-chloro-5-deoxy-d-ribonate
+
** nad biosynthesis i (from aspartate)
* smiles:
+
== Reaction(s) found ==
** c(=o)([o-])c(o)c(o)c(o)ccl
+
* [[L-ASPARTATE-OXID-RXN]]
* inchi-key:
+
* [[NAD-SYNTH-GLN-RXN]]
** ijqsocfskcenow-bxxzvtaosa-m
+
* [[NAD-SYNTH-NH3-RXN]]
* molecular-weight:
+
* [[NICONUCADENYLYLTRAN-RXN]]
** 183.568
+
* [[QUINOLINATE-SYNTHA-RXN]]
== Reaction(s) known to consume the compound ==
+
* [[QUINOPRIBOTRANS-RXN]]
* [[RXN-11717]]
+
== Reaction(s) not found ==
== Reaction(s) known to produce the compound ==
+
All reactions of this pathways are in present
== Reaction(s) of unknown directionality ==
+
{{#set: taxonomic-range=tax-2|tax-2759}}
{{#set: common-name=5-chloro-5-deoxy-d-ribonate}}
+
{{#set: common-name=nad biosynthesis i (from aspartate)}}
{{#set: inchi-key=inchikey=ijqsocfskcenow-bxxzvtaosa-m}}
+
{{#set: nb reaction found=6}}
{{#set: molecular-weight=183.568}}
+
{{#set: completion rate=1.0}}
 +
{{#set: nb total reaction=6}}

Latest revision as of 10:57, 18 March 2021

Pathway PYRIDNUCSYN-PWY

  • taxonomic-range:
    • tax-2759
    • tax-2
  • common-name:
    • nad biosynthesis i (from aspartate)

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present