Difference between revisions of "PYRIDOXAL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLYCEROL-3P == * common-name: ** sn-glycerol 3-phosphate * smiles: ** c(op([o-])(=o)[o-])c(o)co * inchi-key: ** awucvroldviajx-gsvougtgsa...") |
(Created page with "Category:metabolite == Metabolite BIO-5-AMP == * common-name: ** biotinyl-5'-adenylate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op([o-])(=o)oc(=o)ccccc4(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite BIO-5-AMP == |
* common-name: | * common-name: | ||
− | ** | + | ** biotinyl-5'-adenylate |
* smiles: | * smiles: | ||
− | ** c(op([o-])(=o)[o | + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op([o-])(=o)oc(=o)ccccc4(sc[ch]5(nc(=o)n[ch]45)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** utqcstjvmlodhm-rhcayajfsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 572.509 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN0-7192]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=biotinyl-5'-adenylate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=utqcstjvmlodhm-rhcayajfsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=572.509}} |
Revision as of 08:27, 15 March 2021
Contents
Metabolite BIO-5-AMP
- common-name:
- biotinyl-5'-adenylate
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op([o-])(=o)oc(=o)ccccc4(sc[ch]5(nc(=o)n[ch]45))
- inchi-key:
- utqcstjvmlodhm-rhcayajfsa-m
- molecular-weight:
- 572.509