Difference between revisions of "PYRIDOXAL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-178 == * common-name: ** d-myo-inositol (3,4,5,6)-tetrakisphosphate * smiles: ** c1(o)(c(o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op...")
(Created page with "Category:metabolite == Metabolite PYRIDOXAL == * common-name: ** pyridoxal * smiles: ** cc1(n=cc(=c(c=1o)c=o)co) * inchi-key: ** radkzdmfgjycbb-uhfffaoysa-n * molecular-we...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-178 ==
+
== Metabolite PYRIDOXAL ==
 
* common-name:
 
* common-name:
** d-myo-inositol (3,4,5,6)-tetrakisphosphate
+
** pyridoxal
 
* smiles:
 
* smiles:
** c1(o)(c(o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
+
** cc1(n=cc(=c(c=1o)c=o)co)
 
* inchi-key:
 
* inchi-key:
** mrvyfoanpdtyby-uzaagftcsa-f
+
** radkzdmfgjycbb-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 492.013
+
** 167.164
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.134-RXN]]
+
* [[PYRIDOXINE-4-DEHYDROGENASE-RXN]]
 +
* [[PYRIDOXKIN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.1.3.74-RXN]]
 +
* [[PYRIDOXINE-4-DEHYDROGENASE-RXN]]
 +
* [[PYRIDOXINE-4-OXIDASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (3,4,5,6)-tetrakisphosphate}}
+
{{#set: common-name=pyridoxal}}
{{#set: inchi-key=inchikey=mrvyfoanpdtyby-uzaagftcsa-f}}
+
{{#set: inchi-key=inchikey=radkzdmfgjycbb-uhfffaoysa-n}}
{{#set: molecular-weight=492.013}}
+
{{#set: molecular-weight=167.164}}

Latest revision as of 11:14, 18 March 2021

Metabolite PYRIDOXAL

  • common-name:
    • pyridoxal
  • smiles:
    • cc1(n=cc(=c(c=1o)c=o)co)
  • inchi-key:
    • radkzdmfgjycbb-uhfffaoysa-n
  • molecular-weight:
    • 167.164

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality