Difference between revisions of "PYRIDOXAL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19147 == * common-name: ** (7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(o...")
(Created page with "Category:metabolite == Metabolite QUINATE == * common-name: ** l-quinate * smiles: ** c(=o)([o-])c1(o)(cc(o)c(o)c(o)c1) * inchi-key: ** aawzdtnxlsgcek-wywmibkrsa-m * molec...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19147 ==
+
== Metabolite QUINATE ==
 
* common-name:
 
* common-name:
** (7z)-tetradecenoyl-coa
+
** l-quinate
 
* smiles:
 
* smiles:
** ccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(=o)([o-])c1(o)(cc(o)c(o)c(o)c1)
 
* inchi-key:
 
* inchi-key:
** jpihvkickvpffy-twafkmgksa-j
+
** aawzdtnxlsgcek-wywmibkrsa-m
 
* molecular-weight:
 
* molecular-weight:
** 971.845
+
** 191.16
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17792]]
+
* [[RXN-7967]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17791]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(7z)-tetradecenoyl-coa}}
+
{{#set: common-name=l-quinate}}
{{#set: inchi-key=inchikey=jpihvkickvpffy-twafkmgksa-j}}
+
{{#set: inchi-key=inchikey=aawzdtnxlsgcek-wywmibkrsa-m}}
{{#set: molecular-weight=971.845}}
+
{{#set: molecular-weight=191.16}}

Revision as of 13:10, 14 January 2021

Metabolite QUINATE

  • common-name:
    • l-quinate
  • smiles:
    • c(=o)([o-])c1(o)(cc(o)c(o)c(o)c1)
  • inchi-key:
    • aawzdtnxlsgcek-wywmibkrsa-m
  • molecular-weight:
    • 191.16

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality