Difference between revisions of "PYRIDOXAL PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ15251 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RR-BUTANEDIOL-DEHYDROGEN...") |
(Created page with "Category:metabolite == Metabolite PYRIDOXAL_PHOSPHATE == * common-name: ** pyridoxal 5'-phosphate * smiles: ** cc1(n=cc(=c(c=1o)c=o)cop(=o)([o-])[o-]) * inchi-key: ** ngvd...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite PYRIDOXAL_PHOSPHATE == |
| − | == | + | * common-name: |
| − | * [[ | + | ** pyridoxal 5'-phosphate |
| − | == Reaction(s) | + | * smiles: |
| − | * [[ | + | ** cc1(n=cc(=c(c=1o)c=o)cop(=o)([o-])[o-]) |
| − | * | + | * inchi-key: |
| − | * | + | ** ngvdgcnfywlifo-uhfffaoysa-l |
| − | + | * molecular-weight: | |
| − | * [[ | + | ** 245.128 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | * [[ | + | * [[3.1.3.74-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | {{#set: | + | * [[PMPOXI-RXN]] |
| − | {{#set: | + | * [[PNPOXI-RXN]] |
| − | {{#set: | + | * [[PYRIDOXKIN-RXN]] |
| + | * [[RXN-11322]] | ||
| + | * [[RXN-12590]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=pyridoxal 5'-phosphate}} | ||
| + | {{#set: inchi-key=inchikey=ngvdgcnfywlifo-uhfffaoysa-l}} | ||
| + | {{#set: molecular-weight=245.128}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite PYRIDOXAL_PHOSPHATE
- common-name:
- pyridoxal 5'-phosphate
- smiles:
- cc1(n=cc(=c(c=1o)c=o)cop(=o)([o-])[o-])
- inchi-key:
- ngvdgcnfywlifo-uhfffaoysa-l
- molecular-weight:
- 245.128
