Difference between revisions of "PYRIDOXAL PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ACETYL-ETCETERA-L-ASPARAGINE == * common-name: ** n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine * smiles: ** cc(=o)nc1(c(o)c(o)c(co)oc...") |
(Created page with "Category:metabolite == Metabolite PYRIDOXAL_PHOSPHATE == * common-name: ** pyridoxal 5'-phosphate * smiles: ** cc1(n=cc(=c(c=1o)c=o)cop(=o)([o-])[o-]) * inchi-key: ** ngvd...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PYRIDOXAL_PHOSPHATE == |
* common-name: | * common-name: | ||
− | ** | + | ** pyridoxal 5'-phosphate |
* smiles: | * smiles: | ||
− | ** cc(= | + | ** cc1(n=cc(=c(c=1o)c=o)cop(=o)([o-])[o-]) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ngvdgcnfywlifo-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 245.128 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[3. | + | * [[3.1.3.74-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[PMPOXI-RXN]] | ||
+ | * [[PNPOXI-RXN]] | ||
+ | * [[PYRIDOXKIN-RXN]] | ||
+ | * [[RXN-11322]] | ||
+ | * [[RXN-12590]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=pyridoxal 5'-phosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ngvdgcnfywlifo-uhfffaoysa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=245.128}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite PYRIDOXAL_PHOSPHATE
- common-name:
- pyridoxal 5'-phosphate
- smiles:
- cc1(n=cc(=c(c=1o)c=o)cop(=o)([o-])[o-])
- inchi-key:
- ngvdgcnfywlifo-uhfffaoysa-l
- molecular-weight:
- 245.128