Difference between revisions of "PYRIDOXAL PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Trans-D3-cis-D9-hexadecenoyl-ACPs == * common-name: ** a trans-δ3-cis-δ9-hexadecenoyl-[acp] == Reaction(s) known to consume t...")
(Created page with "Category:metabolite == Metabolite PYRIDOXAL_PHOSPHATE == * common-name: ** pyridoxal 5'-phosphate * smiles: ** cc1(n=cc(=c(c=1o)c=o)cop(=o)([o-])[o-]) * inchi-key: ** ngvd...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Trans-D3-cis-D9-hexadecenoyl-ACPs ==
+
== Metabolite PYRIDOXAL_PHOSPHATE ==
 
* common-name:
 
* common-name:
** a trans-δ3-cis-δ9-hexadecenoyl-[acp]
+
** pyridoxal 5'-phosphate
 +
* smiles:
 +
** cc1(n=cc(=c(c=1o)c=o)cop(=o)([o-])[o-])
 +
* inchi-key:
 +
** ngvdgcnfywlifo-uhfffaoysa-l
 +
* molecular-weight:
 +
** 245.128
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10661]]
+
* [[3.1.3.74-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10660]]
+
* [[PMPOXI-RXN]]
 +
* [[PNPOXI-RXN]]
 +
* [[PYRIDOXKIN-RXN]]
 +
* [[RXN-11322]]
 +
* [[RXN-12590]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a trans-δ3-cis-δ9-hexadecenoyl-[acp]}}
+
{{#set: common-name=pyridoxal 5'-phosphate}}
 +
{{#set: inchi-key=inchikey=ngvdgcnfywlifo-uhfffaoysa-l}}
 +
{{#set: molecular-weight=245.128}}

Latest revision as of 11:14, 18 March 2021

Metabolite PYRIDOXAL_PHOSPHATE

  • common-name:
    • pyridoxal 5'-phosphate
  • smiles:
    • cc1(n=cc(=c(c=1o)c=o)cop(=o)([o-])[o-])
  • inchi-key:
    • ngvdgcnfywlifo-uhfffaoysa-l
  • molecular-weight:
    • 245.128

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality