Difference between revisions of "PYRIDOXAMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite METHYL-GLYOXAL == * common-name: ** methylglyoxal * smiles: ** cc([ch]=o)=o * inchi-key: ** aijulsrzwuxgpq-uhfffaoysa-n * molecular-weigh...") |
(Created page with "Category:metabolite == Metabolite CPD-11770 == * common-name: ** 7,8-dihydromonapterin * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) * inchi-key: ** yqifamynggotfb...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11770 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7,8-dihydromonapterin |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yqifamynggotfb-njgyiypdsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 255.233 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-10857]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7,8-dihydromonapterin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yqifamynggotfb-njgyiypdsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=255.233}} |
Revision as of 18:57, 14 January 2021
Contents
Metabolite CPD-11770
- common-name:
- 7,8-dihydromonapterin
- smiles:
- c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2))
- inchi-key:
- yqifamynggotfb-njgyiypdsa-n
- molecular-weight:
- 255.233
