Difference between revisions of "PYRIDOXAMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-713 == * common-name: ** 6-oxocampestanol * smiles: ** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(cc(=o)[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34)))) *...") |
(Created page with "Category:metabolite == Metabolite PYRIDOXAMINE == * common-name: ** pyridoxamine * smiles: ** cc1(=nc=c(co)c(c[n+])=c(o)1) * inchi-key: ** nhzmqxzhnvqtqa-uhfffaoysa-o * mo...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PYRIDOXAMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** pyridoxamine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(=nc=c(co)c(c[n+])=c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nhzmqxzhnvqtqa-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 169.203 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[PYRAMKIN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[PYAMPP]] | ||
| + | * [[RXN-14046]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pyridoxamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nhzmqxzhnvqtqa-uhfffaoysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=169.203}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite PYRIDOXAMINE
- common-name:
- pyridoxamine
- smiles:
- cc1(=nc=c(co)c(c[n+])=c(o)1)
- inchi-key:
- nhzmqxzhnvqtqa-uhfffaoysa-o
- molecular-weight:
- 169.203
