Difference between revisions of "PYRIDOXAMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14950 == * common-name: ** 3-o-methylkaempferol * smiles: ** coc3(c(=o)c1(c(=cc(o)=cc(o)=1)oc(c2(c=cc(o)=cc=2))=3)) * inchi-key: ** v...") |
(Created page with "Category:metabolite == Metabolite PYRIDOXAMINE == * common-name: ** pyridoxamine * smiles: ** cc1(=nc=c(co)c(c[n+])=c(o)1) * inchi-key: ** nhzmqxzhnvqtqa-uhfffaoysa-o * mo...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PYRIDOXAMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** pyridoxamine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(=nc=c(co)c(c[n+])=c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nhzmqxzhnvqtqa-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 169.203 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[PYRAMKIN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[PYAMPP]] |
| + | * [[RXN-14046]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pyridoxamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nhzmqxzhnvqtqa-uhfffaoysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=169.203}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite PYRIDOXAMINE
- common-name:
- pyridoxamine
- smiles:
- cc1(=nc=c(co)c(c[n+])=c(o)1)
- inchi-key:
- nhzmqxzhnvqtqa-uhfffaoysa-o
- molecular-weight:
- 169.203
