Difference between revisions of "PYRIDOXAMINE-5P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMATE-FORMIMINOTRANSFERASE-RXN GLUTAMATE-FORMIMINOTRANSFERASE-RXN] == * direction: ** left-to-r...")
(Created page with "Category:metabolite == Metabolite PYRIDOXAMINE-5P == * common-name: ** pyridoxamine 5'-phosphate * smiles: ** cc1(c(=c(c(cop([o-])([o-])=o)=cn=1)c[n+])o) * inchi-key: ** z...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMATE-FORMIMINOTRANSFERASE-RXN GLUTAMATE-FORMIMINOTRANSFERASE-RXN] ==
+
== Metabolite PYRIDOXAMINE-5P ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** glutamate formimidoyltransferase
+
** pyridoxamine 5'-phosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.1.2.5 ec-2.1.2.5]
+
** cc1(c(=c(c(cop([o-])([o-])=o)=cn=1)c[n+])o)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[N-FORMIMINO-L-GLUTAMATE]][c] '''+''' 1 [[THF-GLU-N]][c] '''=>''' 1 [[CPD-671]][c] '''+''' 1 [[GLT]][c]
+
** zmjgsosnspkhnh-uhfffaoysa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ19600]]
+
** 247.167
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[PMPOXI-RXN]]
−
== Pathway(s) ==
+
* [[PYAMPP]]
−
* [[PWY-5030]], L-histidine degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5030 PWY-5030]
+
* [[RXN-14046]]
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
* [[PYRAMKIN-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=pyridoxamine 5'-phosphate}}
−
* LIGAND-RXN:
+
{{#set: inchi-key=inchikey=zmjgsosnspkhnh-uhfffaoysa-m}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R03189 R03189]
+
{{#set: molecular-weight=247.167}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R02287 R02287]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/P53603 P53603]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=glutamate formimidoyltransferase}}
 
−
{{#set: ec-number=ec-2.1.2.5}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite PYRIDOXAMINE-5P

  • common-name:
    • pyridoxamine 5'-phosphate
  • smiles:
    • cc1(c(=c(c(cop([o-])([o-])=o)=cn=1)c[n+])o)
  • inchi-key:
    • zmjgsosnspkhnh-uhfffaoysa-m
  • molecular-weight:
    • 247.167

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PYRIDOXAMINE-5P&oldid=139579"