Difference between revisions of "PYRIDOXSYN-PWY"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17264 CPD-17264] ==
+== Pathway LIPAS-PWY ==
+* taxonomic-range:
+** tax-2759
+** tax-2
+** tax-2157
 * common-name:
-** (2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa
+** triacylglycerol degradation
-* smiles:
+== Reaction(s) found ==
-** ccc=ccc=ccc=ccc=cccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[3.1.1.23-RXN]]
-* inchi-key:
+* [[TRIACYLGLYCEROL-LIPASE-RXN]]
-** ptromslvpfeiqj-qpyoymcksa-j
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-7952 RXN-7952]
-** 1047.943
+* [NoneRXN-1602 RXN-1602]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=triacylglycerol degradation}}
-* [[RXN-16021]]
+{{#set: nb reaction found=2}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.67}}
-{{#set: common-name=(2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa}}
+{{#set: nb total reaction=3}}
-{{#set: inchi-key=inchikey=ptromslvpfeiqj-qpyoymcksa-j}}
-{{#set: molecular-weight=1047.943}}