Difference between revisions of "Palmitoyl-lipid"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14208 RXN-14208] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:metabolite == Metabolite CPD-13852 == * common-name: ** 2-hydroxy-damp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc(=o)n1)n)n=c2)))o3)o))op([o-])([o-])=o * inchi-key: **...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-13852 == |
| − | * | + | * common-name: |
| − | ** | + | ** 2-hydroxy-damp |
| − | * | + | * smiles: |
| − | ** | + | ** c(c3(c(cc(n2(c1(=c(c(=nc(=o)n1)n)n=c2)))o3)o))op([o-])([o-])=o |
| − | + | * inchi-key: | |
| − | + | ** geqdrkvfkbspsw-kvqbguixsa-l | |
| − | + | * molecular-weight: | |
| − | * | + | ** 345.208 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | ** | + | == Reaction(s) known to produce the compound == |
| − | == | + | * [[RXN0-6957]] |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | * | + | {{#set: common-name=2-hydroxy-damp}} |
| − | == | + | {{#set: inchi-key=inchikey=geqdrkvfkbspsw-kvqbguixsa-l}} |
| − | {{#set: | + | {{#set: molecular-weight=345.208}} |
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Revision as of 20:37, 18 December 2020
Contents
Metabolite CPD-13852
- common-name:
- 2-hydroxy-damp
- smiles:
- c(c3(c(cc(n2(c1(=c(c(=nc(=o)n1)n)n=c2)))o3)o))op([o-])([o-])=o
- inchi-key:
- geqdrkvfkbspsw-kvqbguixsa-l
- molecular-weight:
- 345.208
