Difference between revisions of "Palmitoyl-proteins"

Revision as of 14:56, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CANAVANINOSUCCINATE ==
+== Metabolite SUCC-S-ALD ==
 * common-name:
-** canavaninosuccinate
+** succinate semialdehyde
 * smiles:
-** c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o
+** c([ch]=o)cc(=o)[o-]
 * inchi-key:
-** sgymgugigtwwlu-rolxfiacsa-m
+** uiujiqzeacwqsv-uhfffaoysa-m
 * molecular-weight:
-** 291.24
+** 101.082
 == Reaction(s) known to consume the compound ==
-* [[RXN-22]]
+* [[GABATRANSAM-RXN]]
+* [[RXN-14146]]
+* [[RXN0-5293]]
+* [[SSNOm]]
+* [[SUCCINATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
+* [[SUCCSEMIALDDEHYDROG-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-10]]
+* [[4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN]]
+* [[GABATRANSAM-RXN]]
+* [[RXN-14146]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=canavaninosuccinate}}
+{{#set: common-name=succinate semialdehyde}}
-{{#set: inchi-key=inchikey=sgymgugigtwwlu-rolxfiacsa-m}}
+{{#set: inchi-key=inchikey=uiujiqzeacwqsv-uhfffaoysa-m}}
-{{#set: molecular-weight=291.24}}
+{{#set: molecular-weight=101.082}}