Difference between revisions of "Palmitoyl-proteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SUCC-S-ALD == * common-name: ** succinate semialdehyde * smiles: ** c([ch]=o)cc(=o)[o-] * inchi-key: ** uiujiqzeacwqsv-uhfffaoysa-m * mol...") |
(Created page with "Category:metabolite == Metabolite CANAVANINOSUCCINATE == * common-name: ** canavaninosuccinate * smiles: ** c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o * inchi-k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CANAVANINOSUCCINATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** canavaninosuccinate |
* smiles: | * smiles: | ||
| − | ** c([ | + | ** c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** sgymgugigtwwlu-rolxfiacsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 291.24 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-22]] | |
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-10]] | |
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=canavaninosuccinate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sgymgugigtwwlu-rolxfiacsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=291.24}} |
Revision as of 15:27, 5 January 2021
Contents
Metabolite CANAVANINOSUCCINATE
- common-name:
- canavaninosuccinate
- smiles:
- c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o
- inchi-key:
- sgymgugigtwwlu-rolxfiacsa-m
- molecular-weight:
- 291.24
