Difference between revisions of "Palmitoyl-proteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CANAVANINOSUCCINATE == * common-name: ** canavaninosuccinate * smiles: ** c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o * inchi-k...") |
(Created page with "Category:metabolite == Metabolite Myo-inositol-polyphosphates == * common-name: ** a myo-inositol-polyphosphate == Reaction(s) known to consume the compound == * 3.6.1.5...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Myo-inositol-polyphosphates == |
* common-name: | * common-name: | ||
| − | ** | + | ** a myo-inositol-polyphosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[3.6.1.52-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[3.6.1.52-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a myo-inositol-polyphosphate}} |
| − | |||
| − | |||
Revision as of 13:10, 14 January 2021
Contents
Metabolite Myo-inositol-polyphosphates
- common-name:
- a myo-inositol-polyphosphate
