Difference between revisions of "Peptide-3-hydroxy-L-Aspartates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PORPHOBILINOGEN == * common-name: ** porphobilinogen * smiles: ** c(c1(=c(c(=cn1)ccc(=o)[o-])cc(=o)[o-]))[n+] * inchi-key: ** qshwiqzfgqk...") |
(Created page with "Category:metabolite == Metabolite CPD-309 == * common-name: ** d-octopine * smiles: ** cc(c([o-])=o)[n+]c(c([o-])=o)cccnc(n)=[n+] * inchi-key: ** imxsccduafeioe-ritpcoansa...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-309 == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-octopine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c([o-])=o)[n+]c(c([o-])=o)cccnc(n)=[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** imxsccduafeioe-ritpcoansa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 246.266 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[D-OCTOPINE-DEHYDROGENASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1.5.1.11-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-octopine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=imxsccduafeioe-ritpcoansa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=246.266}} |
Revision as of 11:14, 15 January 2021
Contents
Metabolite CPD-309
- common-name:
- d-octopine
- smiles:
- cc(c([o-])=o)[n+]c(c([o-])=o)cccnc(n)=[n+]
- inchi-key:
- imxsccduafeioe-ritpcoansa-n
- molecular-weight:
- 246.266
