Difference between revisions of "Peptide-with-N-terminal-Aspartate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-206 == * common-name: ** phytanoyl-coa * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op...")
(Created page with "Category:metabolite == Metabolite Peptide-with-N-terminal-Aspartate == * common-name: ** a peptide with an n-terminal l-aspartate == Reaction(s) known to consume the compo...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-206 ==
+
== Metabolite Peptide-with-N-terminal-Aspartate ==
 
* common-name:
 
* common-name:
** phytanoyl-coa
+
** a peptide with an n-terminal l-aspartate
* smiles:
 
** cc(c)cccc(c)cccc(c)cccc(c)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** nrjqghhzmsouen-hhvnvsiesa-j
 
* molecular-weight:
 
** 1058.022
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.14.11.18-RXN]]
+
* [[3.4.11.21-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-482]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phytanoyl-coa}}
+
{{#set: common-name=a peptide with an n-terminal l-aspartate}}
{{#set: inchi-key=inchikey=nrjqghhzmsouen-hhvnvsiesa-j}}
 
{{#set: molecular-weight=1058.022}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Peptide-with-N-terminal-Aspartate

  • common-name:
    • a peptide with an n-terminal l-aspartate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality