Difference between revisions of "Peptides-holder"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MALONYL-COA == * common-name: ** malonyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o...")
(Created page with "Category:metabolite == Metabolite COUMARYL-ALCOHOL == * common-name: ** 4-coumaryl alcohol * smiles: ** c(=cc1(=cc=c(o)c=c1))co * inchi-key: ** ptnlhdgqwugons-owojbtedsa-n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MALONYL-COA ==
+
== Metabolite COUMARYL-ALCOHOL ==
 
* common-name:
 
* common-name:
** malonyl-coa
+
** 4-coumaryl alcohol
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(=cc1(=cc=c(o)c=c1))co
 
* inchi-key:
 
* inchi-key:
** ltyoqgrjfjakna-dvvlenmvsa-i
+
** ptnlhdgqwugons-owojbtedsa-n
 
* molecular-weight:
 
* molecular-weight:
** 848.541
+
** 150.177
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[ACOACXr]]
 
* [[FATTY-ACID-SYNTHASE-RXN]]
 
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
 
* [[MALONYL-COA-DECARBOXYLASE-RXN]]
 
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
 
* [[RXN-10059]]
 
* [[RXN-10734]]
 
* [[RXN-12777]]
 
* [[RXN-13294]]
 
* [[RXN-13295]]
 
* [[RXN-13296]]
 
* [[RXN-13297]]
 
* [[RXN-13322]]
 
* [[RXN-13431]]
 
* [[RXN-13441]]
 
* [[RXN-14492]]
 
* [[RXN-16016]]
 
* [[RXN-16017]]
 
* [[RXN-16094]]
 
* [[RXN-16153]]
 
* [[RXN-3142]]
 
* [[RXN-7645]]
 
* [[RXN-7697]]
 
* [[RXN-9543]]
 
* [[RXN-9632]]
 
* [[RXN-9648]]
 
* [[RXN-9650]]
 
* [[RXN-9651]]
 
* [[RXN-9652]]
 
* [[RXN-9653]]
 
* [[RXN-9654]]
 
* [[RXN1G-368]]
 
* [[RXN1G-445]]
 
* [[RXN1G-499]]
 
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
+
* [[RXN-1102]]
* [[RXN0-5055]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=malonyl-coa}}
+
{{#set: common-name=4-coumaryl alcohol}}
{{#set: inchi-key=inchikey=ltyoqgrjfjakna-dvvlenmvsa-i}}
+
{{#set: inchi-key=inchikey=ptnlhdgqwugons-owojbtedsa-n}}
{{#set: molecular-weight=848.541}}
+
{{#set: molecular-weight=150.177}}

Revision as of 08:24, 15 March 2021

Metabolite COUMARYL-ALCOHOL

  • common-name:
    • 4-coumaryl alcohol
  • smiles:
    • c(=cc1(=cc=c(o)c=c1))co
  • inchi-key:
    • ptnlhdgqwugons-owojbtedsa-n
  • molecular-weight:
    • 150.177

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality