Difference between revisions of "Peptides-holder"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MALONYL-COA == * common-name: ** malonyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o...")
(Created page with "Category:metabolite == Metabolite Peptides-holder == * common-name: ** a peptide == Reaction(s) known to consume the compound == * 3.4.17.19-RXN * 3.4.17.21-RXN *...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite MALONYL-COA ==
+
== Metabolite Peptides-holder ==
 
* common-name:
 
* common-name:
−
** malonyl-coa
+
** a peptide
−
* smiles:
 
−
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
−
* inchi-key:
 
−
** ltyoqgrjfjakna-dvvlenmvsa-i
 
−
* molecular-weight:
 
−
** 848.541
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.4.17.19-RXN]]
 +
* [[3.4.17.21-RXN]]
 +
* [[3.4.17.22-RXN]]
 +
* [[3.6.3.43-RXN]]
 +
* [[CARBOXYPEPTIDASE-A-RXN]]
 +
== Reaction(s) known to produce the compound ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
* [[ACOACXr]]
+
* [[3.4.11.18-RXN]]
−
* [[FATTY-ACID-SYNTHASE-RXN]]
+
* [[3.4.11.2-RXN]]
−
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
+
* [[3.4.11.21-RXN]]
−
* [[MALONYL-COA-DECARBOXYLASE-RXN]]
+
* [[3.4.11.5-RXN]]
−
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
+
* [[3.4.14.10-RXN]]
−
* [[RXN-10059]]
+
* [[3.4.14.5-RXN]]
−
* [[RXN-10734]]
+
* [[3.4.14.9-RXN]]
−
* [[RXN-12777]]
+
* [[3.4.16.2-RXN]]
−
* [[RXN-13294]]
+
* [[3.4.17.19-RXN]]
−
* [[RXN-13295]]
+
* [[3.4.17.21-RXN]]
−
* [[RXN-13296]]
+
* [[3.4.17.22-RXN]]
−
* [[RXN-13297]]
+
* [[3.4.18.1-RXN]]
−
* [[RXN-13322]]
+
* [[3.4.21.102-RXN]]
−
* [[RXN-13431]]
+
* [[3.4.21.112-RXN]]
−
* [[RXN-13441]]
+
* [[3.4.21.26-RXN]]
−
* [[RXN-14492]]
+
* [[3.4.21.4-RXN]]
−
* [[RXN-16016]]
+
* [[3.4.21.53-RXN]]
−
* [[RXN-16017]]
+
* [[3.4.21.83-RXN]]
−
* [[RXN-16094]]
+
* [[3.4.21.89-RXN]]
−
* [[RXN-16153]]
+
* [[3.4.21.92-RXN]]
−
* [[RXN-3142]]
+
* [[3.4.22.1-RXN]]
−
* [[RXN-7645]]
+
* [[3.4.22.15-RXN]]
−
* [[RXN-7697]]
+
* [[3.4.22.16-RXN]]
−
* [[RXN-9543]]
+
* [[3.4.22.34-RXN]]
−
* [[RXN-9632]]
+
* [[3.4.22.41-RXN]]
−
* [[RXN-9648]]
+
* [[3.4.23.1-RXN]]
−
* [[RXN-9650]]
+
* [[3.4.23.34-RXN]]
−
* [[RXN-9651]]
+
* [[3.4.23.5-RXN]]
−
* [[RXN-9652]]
+
* [[3.4.24.56-RXN]]
−
* [[RXN-9653]]
+
* [[3.4.24.57-RXN]]
−
* [[RXN-9654]]
+
* [[3.4.24.61-RXN]]
−
* [[RXN1G-368]]
+
* [[3.4.24.64-RXN]]
−
* [[RXN1G-445]]
+
* [[3.4.24.70-RXN]]
−
* [[RXN1G-499]]
+
* [[3.4.25.1-RXN]]
 +
* [[3.6.3.43-RXN]]
 +
* [[ACYLAMINOACYL-PEPTIDASE-RXN]]
 +
* [[CARBOXYPEPTIDASE-A-RXN]]
 +
* [[GAMMA-GLUTAMYLTRANSFERASE-RXN]]
 +
* [[RXN-11136]]
 +
* [[RXN-11693]]
 +
* [[RXN-11698]]
 +
* [[RXN0-3201]]
 +
* [[RXN0-5204]]
 
</div>
 
</div>
−
== Reaction(s) known to produce the compound ==
 
−
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
 
−
* [[RXN0-5055]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=malonyl-coa}}
+
{{#set: common-name=a peptide}}
−
{{#set: inchi-key=inchikey=ltyoqgrjfjakna-dvvlenmvsa-i}}
 
−
{{#set: molecular-weight=848.541}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Peptides-holder

  • common-name:
    • a peptide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Peptides-holder&oldid=136900"