Difference between revisions of "Peptides-holder"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7088 == * common-name: ** (2r,3s,4s)-leucodelphinidin * smiles: ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc(o)=c(c(o)=3)o) * inchi-ke...")
(Created page with "Category:metabolite == Metabolite Peptides-holder == * common-name: ** a peptide == Reaction(s) known to consume the compound == * 3.4.17.19-RXN * 3.4.17.21-RXN *...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7088 ==
+
== Metabolite Peptides-holder ==
 
* common-name:
 
* common-name:
** (2r,3s,4s)-leucodelphinidin
+
** a peptide
* smiles:
 
** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc(o)=c(c(o)=3)o)
 
* inchi-key:
 
** zeacokjoqlaytd-souvjxgzsa-n
 
* molecular-weight:
 
** 322.271
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.4.17.19-RXN]]
 +
* [[3.4.17.21-RXN]]
 +
* [[3.4.17.22-RXN]]
 +
* [[3.6.3.43-RXN]]
 +
* [[CARBOXYPEPTIDASE-A-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7784]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[3.4.11.18-RXN]]
 +
* [[3.4.11.2-RXN]]
 +
* [[3.4.11.21-RXN]]
 +
* [[3.4.11.5-RXN]]
 +
* [[3.4.14.10-RXN]]
 +
* [[3.4.14.5-RXN]]
 +
* [[3.4.14.9-RXN]]
 +
* [[3.4.16.2-RXN]]
 +
* [[3.4.17.19-RXN]]
 +
* [[3.4.17.21-RXN]]
 +
* [[3.4.17.22-RXN]]
 +
* [[3.4.18.1-RXN]]
 +
* [[3.4.21.102-RXN]]
 +
* [[3.4.21.112-RXN]]
 +
* [[3.4.21.26-RXN]]
 +
* [[3.4.21.4-RXN]]
 +
* [[3.4.21.53-RXN]]
 +
* [[3.4.21.83-RXN]]
 +
* [[3.4.21.89-RXN]]
 +
* [[3.4.21.92-RXN]]
 +
* [[3.4.22.1-RXN]]
 +
* [[3.4.22.15-RXN]]
 +
* [[3.4.22.16-RXN]]
 +
* [[3.4.22.34-RXN]]
 +
* [[3.4.22.41-RXN]]
 +
* [[3.4.23.1-RXN]]
 +
* [[3.4.23.34-RXN]]
 +
* [[3.4.23.5-RXN]]
 +
* [[3.4.24.56-RXN]]
 +
* [[3.4.24.57-RXN]]
 +
* [[3.4.24.61-RXN]]
 +
* [[3.4.24.64-RXN]]
 +
* [[3.4.24.70-RXN]]
 +
* [[3.4.25.1-RXN]]
 +
* [[3.6.3.43-RXN]]
 +
* [[ACYLAMINOACYL-PEPTIDASE-RXN]]
 +
* [[CARBOXYPEPTIDASE-A-RXN]]
 +
* [[GAMMA-GLUTAMYLTRANSFERASE-RXN]]
 +
* [[RXN-11136]]
 +
* [[RXN-11693]]
 +
* [[RXN-11698]]
 +
* [[RXN0-3201]]
 +
* [[RXN0-5204]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2r,3s,4s)-leucodelphinidin}}
+
{{#set: common-name=a peptide}}
{{#set: inchi-key=inchikey=zeacokjoqlaytd-souvjxgzsa-n}}
 
{{#set: molecular-weight=322.271}}
 

Latest revision as of 11:11, 18 March 2021