Difference between revisions of "Peptides-holder"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ACETYL-COA == * common-name: ** acetyl-coa * smiles: ** cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1...")
(Created page with "Category:metabolite == Metabolite Peptides-holder == * common-name: ** a peptide == Reaction(s) known to consume the compound == * 3.4.17.19-RXN * 3.4.17.21-RXN *...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite ACETYL-COA ==
+
== Metabolite Peptides-holder ==
 
* common-name:
 
* common-name:
−
** acetyl-coa
+
** a peptide
−
* smiles:
 
−
** cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
−
* inchi-key:
 
−
** zslzbfcdcinbpy-zsjpkinusa-j
 
−
* molecular-weight:
 
−
** 805.54
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[3.4.17.19-RXN]]
−
* [[1.2.1.18-RXN]]
+
* [[3.4.17.21-RXN]]
−
* [[2-ISOPROPYLMALATESYN-RXN]]
+
* [[3.4.17.22-RXN]]
−
* [[2.3.1.157-RXN]]
+
* [[3.6.3.43-RXN]]
−
* [[2.3.1.180-RXN]]
+
* [[CARBOXYPEPTIDASE-A-RXN]]
−
* [[2.3.1.45-RXN]]
 
−
* [[2.3.1.67-RXN]]
 
−
* [[ACACT]]
 
−
* [[ACACT1h]]
 
−
* [[ACACT2h]]
 
−
* [[ACACT4]]
 
−
* [[ACACT4h]]
 
−
* [[ACACT6]]
 
−
* [[ACACT6h]]
 
−
* [[ACACT7]]
 
−
* [[ACACT7h]]
 
−
* [[ACACT7m]]
 
−
* [[ACCOAth]]
 
−
* [[ACCOAtm]]
 
−
* [[ACCOAtx]]
 
−
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
 
−
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
 
−
* [[ACP-S-ACETYLTRANSFER-RXN]]
 
−
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
 
−
* [[CITSYN-RXN]]
 
−
* [[CSm]]
 
−
* [[DIHYDLIPACETRANS-RXN]]
 
−
* [[FATTY-ACID-SYNTHASE-RXN]]
 
−
* [[HISTONE-ACETYLTRANSFERASE-RXN]]
 
−
* [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]]
 
−
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 
−
* [[IPMS]]
 
−
* [[MALSYN-RXN]]
 
−
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 
−
* [[N-ACETYLTRANSFER-RXN]]
 
−
* [[PHOSACETYLTRANS-RXN]]
 
−
* [[PYFLAVOXRE-RXN]]
 
−
* [[PYRUFLAVREDUCT-RXN]]
 
−
* [[RXN-12565]]
 
−
* [[RXN-13431]]
 
−
* [[RXN-14274]]
 
−
* [[RXN-14277]]
 
−
* [[RXN-16016]]
 
−
* [[RXN-16017]]
 
−
* [[RXN-7864]]
 
−
* [[RXN-8032]]
 
−
* [[RXN0-5055]]
 
−
* [[RXN0-6948]]
 
−
* [[SERINE-O-ACETTRAN-RXN]]
 
−
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
* [[1.2.1.18-RXN]]
+
* [[3.4.11.18-RXN]]
−
* [[2.3.1.45-RXN]]
+
* [[3.4.11.2-RXN]]
−
* [[2.3.1.67-RXN]]
+
* [[3.4.11.21-RXN]]
−
* [[ACACT1h]]
+
* [[3.4.11.5-RXN]]
−
* [[ACACT4]]
+
* [[3.4.14.10-RXN]]
−
* [[ACACT6]]
+
* [[3.4.14.5-RXN]]
−
* [[ACACT7]]
+
* [[3.4.14.9-RXN]]
−
* [[ACCAT]]
+
* [[3.4.16.2-RXN]]
−
* [[ACCOAth]]
+
* [[3.4.17.19-RXN]]
−
* [[ACCOAtm]]
+
* [[3.4.17.21-RXN]]
−
* [[ACCOAtx]]
+
* [[3.4.17.22-RXN]]
−
* [[ACECOATRANS-RXN-CPD-10280/ACET//TETRACOSANOATE/ACETYL-COA.42.]]
+
* [[3.4.18.1-RXN]]
−
* [[ACECOATRANS-RXN-CPD-14717/ACET//R-2-HYDROXYSTEARATE/ACETYL-COA.47.]]
+
* [[3.4.21.102-RXN]]
−
* [[ACECOATRANS-RXN-CPD-196/ACET//CPD-195/ACETYL-COA.33.]]
+
* [[3.4.21.112-RXN]]
−
* [[ACECOATRANS-RXN-HEXANOYL-COA/ACET//HEXANOATE/ACETYL-COA.40.]]
+
* [[3.4.21.26-RXN]]
−
* [[ACETATE--COA-LIGASE-RXN]]
+
* [[3.4.21.4-RXN]]
−
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
+
* [[3.4.21.53-RXN]]
−
* [[ACOACXr]]
+
* [[3.4.21.83-RXN]]
−
* [[ACP-S-ACETYLTRANSFER-RXN]]
+
* [[3.4.21.89-RXN]]
−
* [[AKBLIG-RXN]]
+
* [[3.4.21.92-RXN]]
−
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
+
* [[3.4.22.1-RXN]]
−
* [[ATPCL]]
+
* [[3.4.22.15-RXN]]
−
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
+
* [[3.4.22.16-RXN]]
−
* [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]]
+
* [[3.4.22.34-RXN]]
−
* [[HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN]]
+
* [[3.4.22.41-RXN]]
−
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
+
* [[3.4.23.1-RXN]]
−
* [[KETOACYLCOATHIOL-RXN]]
+
* [[3.4.23.34-RXN]]
−
* [[MALONYL-COA-DECARBOXYLASE-RXN]]
+
* [[3.4.23.5-RXN]]
−
* [[METHYLACETOACETYLCOATHIOL-RXN]]
+
* [[3.4.24.56-RXN]]
−
* [[N-ACETYLTRANSFER-RXN]]
+
* [[3.4.24.57-RXN]]
−
* [[PHOSACETYLTRANS-RXN]]
+
* [[3.4.24.61-RXN]]
−
* [[PYFLAVOXRE-RXN]]
+
* [[3.4.24.64-RXN]]
−
* [[PYRUFLAVREDUCT-RXN]]
+
* [[3.4.24.70-RXN]]
−
* [[PYRUVDEH-RXN]]
+
* [[3.4.25.1-RXN]]
−
* [[RXN-10699]]
+
* [[3.6.3.43-RXN]]
−
* [[RXN-10700]]
+
* [[ACYLAMINOACYL-PEPTIDASE-RXN]]
−
* [[RXN-10701]]
+
* [[CARBOXYPEPTIDASE-A-RXN]]
−
* [[RXN-11246]]
+
* [[GAMMA-GLUTAMYLTRANSFERASE-RXN]]
−
* [[RXN-11917]]
+
* [[RXN-11136]]
−
* [[RXN-11921]]
+
* [[RXN-11693]]
−
* [[RXN-12561]]
+
* [[RXN-11698]]
−
* [[RXN-12710]]
+
* [[RXN0-3201]]
−
* [[RXN-13617]]
+
* [[RXN0-5204]]
−
* [[RXN-14268]]
 
−
* [[RXN-14274]]
 
−
* [[RXN-14277]]
 
−
* [[RXN-14394]]
 
−
* [[RXN-14774]]
 
−
* [[RXN-14788]]
 
−
* [[RXN-14793]]
 
−
* [[RXN-14799]]
 
−
* [[RXN-14803]]
 
−
* [[RXN-16137]]
 
−
* [[RXN-17116]]
 
−
* [[RXN-17778]]
 
−
* [[RXN-17782]]
 
−
* [[RXN-17787]]
 
−
* [[RXN-17791]]
 
−
* [[RXN-17795]]
 
−
* [[RXN-17799]]
 
−
* [[RXN-2006]]
 
−
* [[RXN-2902]]
 
−
* [[RXN-7864]]
 
−
* [[RXN-8032]]
 
−
* [[RXN-9958]]
 
−
* [[RXN0-1133]]
 
 
</div>
 
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=acetyl-coa}}
+
{{#set: common-name=a peptide}}
−
{{#set: inchi-key=inchikey=zslzbfcdcinbpy-zsjpkinusa-j}}
 
−
{{#set: molecular-weight=805.54}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Peptides-holder

  • common-name:
    • a peptide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Peptides-holder&oldid=136900"