Difference between revisions of "Peptides-holder"

Revision as of 20:30, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:gene]]
+[[Category:metabolite]]
-== Gene SJ04846 ==
+== Metabolite CPD-7088 ==
-* transcription-direction:
+* common-name:
-** negative
+** (2r,3s,4s)-leucodelphinidin
-* right-end-position:
+* smiles:
-** 439094
+** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc(o)=c(c(o)=3)o)
-* left-end-position:
+* inchi-key:
-** 437695
+** zeacokjoqlaytd-souvjxgzsa-n
-* centisome-position:
+* molecular-weight:
-** 86.62853
+** 322.271
-== Organism(s) associated with this gene  ==
+== Reaction(s) known to consume the compound ==
-* [[S.japonica_carotenoid_curated]]
+== Reaction(s) known to produce the compound ==
-== Reaction(s) associated ==
+* [[RXN-7784]]
-* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+== Reaction(s) of unknown directionality ==
-** Category: [[annotation]]
+{{#set: common-name=(2r,3s,4s)-leucodelphinidin}}
-*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+{{#set: inchi-key=inchikey=zeacokjoqlaytd-souvjxgzsa-n}}
-{{#set: transcription-direction=negative}}
+{{#set: molecular-weight=322.271}}
-{{#set: right-end-position=439094}}
-{{#set: left-end-position=437695}}
-{{#set: centisome-position=86.62853    }}
-{{#set: organism associated=S.japonica_carotenoid_curated}}
-{{#set: nb reaction associated=1}}