|
|
| Line 1: |
Line 1: |
| | [[Category:metabolite]] | | [[Category:metabolite]] |
| − | == Metabolite ACETYL-COA == | + | == Metabolite 3-INDOLYLGLYCOLALDEHYDE == |
| | * common-name: | | * common-name: |
| − | ** acetyl-coa | + | ** indole-3-glycol aldehyde |
| | * smiles: | | * smiles: |
| − | ** cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | + | ** c2(=c(c1(c=cc=cc=1n2))c(o)c=o) |
| | * inchi-key: | | * inchi-key: |
| − | ** zslzbfcdcinbpy-zsjpkinusa-j | + | ** xkzdnwmdlgqxml-uhfffaoysa-n |
| | * molecular-weight: | | * molecular-weight: |
| − | ** 805.54 | + | ** 175.187 |
| | == Reaction(s) known to consume the compound == | | == Reaction(s) known to consume the compound == |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | * [[RXN-5424]] |
| − | * [[1.2.1.18-RXN]]
| |
| − | * [[2-ISOPROPYLMALATESYN-RXN]]
| |
| − | * [[2.3.1.157-RXN]]
| |
| − | * [[2.3.1.180-RXN]]
| |
| − | * [[2.3.1.45-RXN]]
| |
| − | * [[2.3.1.67-RXN]]
| |
| − | * [[ACACT]]
| |
| − | * [[ACACT1h]]
| |
| − | * [[ACACT2h]]
| |
| − | * [[ACACT4]]
| |
| − | * [[ACACT4h]]
| |
| − | * [[ACACT6]]
| |
| − | * [[ACACT6h]]
| |
| − | * [[ACACT7]]
| |
| − | * [[ACACT7h]]
| |
| − | * [[ACACT7m]]
| |
| − | * [[ACCOAth]]
| |
| − | * [[ACCOAtm]]
| |
| − | * [[ACCOAtx]]
| |
| − | * [[ACETYL-COA-ACETYLTRANSFER-RXN]]
| |
| − | * [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
| |
| − | * [[ACP-S-ACETYLTRANSFER-RXN]]
| |
| − | * [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
| |
| − | * [[CITSYN-RXN]]
| |
| − | * [[CSm]]
| |
| − | * [[DIHYDLIPACETRANS-RXN]]
| |
| − | * [[FATTY-ACID-SYNTHASE-RXN]]
| |
| − | * [[HISTONE-ACETYLTRANSFERASE-RXN]]
| |
| − | * [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]]
| |
| − | * [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
| |
| − | * [[IPMS]]
| |
| − | * [[MALSYN-RXN]]
| |
| − | * [[METHYLACETOACETYLCOATHIOL-RXN]]
| |
| − | * [[N-ACETYLTRANSFER-RXN]]
| |
| − | * [[PHOSACETYLTRANS-RXN]] | |
| − | * [[PYFLAVOXRE-RXN]]
| |
| − | * [[PYRUFLAVREDUCT-RXN]]
| |
| − | * [[RXN-12565]]
| |
| − | * [[RXN-13431]]
| |
| − | * [[RXN-14274]]
| |
| − | * [[RXN-14277]]
| |
| − | * [[RXN-16016]]
| |
| − | * [[RXN-16017]]
| |
| − | * [[RXN-7864]]
| |
| − | * [[RXN-8032]]
| |
| − | * [[RXN0-5055]]
| |
| − | * [[RXN0-6948]]
| |
| − | * [[SERINE-O-ACETTRAN-RXN]]
| |
| − | </div>
| |
| | == Reaction(s) known to produce the compound == | | == Reaction(s) known to produce the compound == |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[1.2.1.18-RXN]]
| |
| − | * [[2.3.1.45-RXN]]
| |
| − | * [[2.3.1.67-RXN]]
| |
| − | * [[ACACT1h]]
| |
| − | * [[ACACT4]]
| |
| − | * [[ACACT6]]
| |
| − | * [[ACACT7]]
| |
| − | * [[ACCAT]]
| |
| − | * [[ACCOAth]]
| |
| − | * [[ACCOAtm]]
| |
| − | * [[ACCOAtx]]
| |
| − | * [[ACECOATRANS-RXN-CPD-10280/ACET//TETRACOSANOATE/ACETYL-COA.42.]]
| |
| − | * [[ACECOATRANS-RXN-CPD-14717/ACET//R-2-HYDROXYSTEARATE/ACETYL-COA.47.]]
| |
| − | * [[ACECOATRANS-RXN-CPD-196/ACET//CPD-195/ACETYL-COA.33.]]
| |
| − | * [[ACECOATRANS-RXN-HEXANOYL-COA/ACET//HEXANOATE/ACETYL-COA.40.]]
| |
| − | * [[ACETATE--COA-LIGASE-RXN]]
| |
| − | * [[ACETYL-COA-ACETYLTRANSFER-RXN]]
| |
| − | * [[ACOACXr]]
| |
| − | * [[ACP-S-ACETYLTRANSFER-RXN]]
| |
| − | * [[AKBLIG-RXN]]
| |
| − | * [[ATP-CITRATE-PRO-S--LYASE-RXN]]
| |
| − | * [[ATPCL]]
| |
| − | * [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
| |
| − | * [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]]
| |
| − | * [[HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN]]
| |
| − | * [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
| |
| − | * [[KETOACYLCOATHIOL-RXN]]
| |
| − | * [[MALONYL-COA-DECARBOXYLASE-RXN]]
| |
| − | * [[METHYLACETOACETYLCOATHIOL-RXN]]
| |
| − | * [[N-ACETYLTRANSFER-RXN]]
| |
| − | * [[PHOSACETYLTRANS-RXN]]
| |
| − | * [[PYFLAVOXRE-RXN]]
| |
| − | * [[PYRUFLAVREDUCT-RXN]]
| |
| − | * [[PYRUVDEH-RXN]]
| |
| − | * [[RXN-10699]]
| |
| − | * [[RXN-10700]]
| |
| − | * [[RXN-10701]]
| |
| − | * [[RXN-11246]]
| |
| − | * [[RXN-11917]]
| |
| − | * [[RXN-11921]]
| |
| − | * [[RXN-12561]]
| |
| − | * [[RXN-12710]]
| |
| − | * [[RXN-13617]]
| |
| − | * [[RXN-14268]]
| |
| − | * [[RXN-14274]]
| |
| − | * [[RXN-14277]]
| |
| − | * [[RXN-14394]]
| |
| − | * [[RXN-14774]]
| |
| − | * [[RXN-14788]]
| |
| − | * [[RXN-14793]]
| |
| − | * [[RXN-14799]]
| |
| − | * [[RXN-14803]]
| |
| − | * [[RXN-16137]]
| |
| − | * [[RXN-17116]]
| |
| − | * [[RXN-17778]]
| |
| − | * [[RXN-17782]]
| |
| − | * [[RXN-17787]]
| |
| − | * [[RXN-17791]]
| |
| − | * [[RXN-17795]]
| |
| − | * [[RXN-17799]]
| |
| − | * [[RXN-2006]]
| |
| − | * [[RXN-2902]]
| |
| − | * [[RXN-7864]]
| |
| − | * [[RXN-8032]]
| |
| − | * [[RXN-9958]]
| |
| − | * [[RXN0-1133]]
| |
| − | </div>
| |
| | == Reaction(s) of unknown directionality == | | == Reaction(s) of unknown directionality == |
| − | {{#set: common-name=acetyl-coa}} | + | {{#set: common-name=indole-3-glycol aldehyde}} |
| − | {{#set: inchi-key=inchikey=zslzbfcdcinbpy-zsjpkinusa-j}} | + | {{#set: inchi-key=inchikey=xkzdnwmdlgqxml-uhfffaoysa-n}} |
| − | {{#set: molecular-weight=805.54}} | + | {{#set: molecular-weight=175.187}} |
