Difference between revisions of "Peptides-holder"

Revision as of 18:53, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite 3-INDOLYLGLYCOLALDEHYDE ==
+== Metabolite OXALACETIC_ACID ==
 * common-name:
-** indole-3-glycol aldehyde
+** oxaloacetate
 * smiles:
-** c2(=c(c1(c=cc=cc=1n2))c(o)c=o)
+** c(c([o-])=o)c(=o)c([o-])=o
 * inchi-key:
-** xkzdnwmdlgqxml-uhfffaoysa-n
+** khpxuqmniqbqev-uhfffaoysa-l
 * molecular-weight:
-** 175.187
+** 130.057
 == Reaction(s) known to consume the compound ==
-* [[RXN-5424]]
+* [[ASPAMINOTRANS-RXN]]
+* [[CITSYN-RXN]]
+* [[CSm]]
+* [[MALATE-DEH-RXN]]
+* [[MALATE-DEHYDROGENASE-NADP+-RXN]]
+* [[OAAAKGtm]]
+* [[OAACITtm]]
+* [[OXALODECARB-RXN]]
+* [[PCr]]
+* [[PEPCARBOXYKIN-RXN]]
+* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
+* [[RXN-13697]]
+* [[RXN-2464]]
 == Reaction(s) known to produce the compound ==
+* [[ASPAMINOTRANS-RXN]]
+* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
+* [[ATPCL]]
+* [[MALATE-DEH-RXN]]
+* [[OAAAKGtm]]
+* [[OAACITtm]]
+* [[OXALOACETATE-TAUTOMERASE-RXN]]
+* [[PCr]]
+* [[PEPCARBOX-RXN]]
+* [[PPC]]
+* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
+* [[PYRUVATE-CARBOXYLASE-RXN]]
+* [[RXN-13697]]
+* [[RXN-2464]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=indole-3-glycol aldehyde}}
+{{#set: common-name=oxaloacetate}}
-{{#set: inchi-key=inchikey=xkzdnwmdlgqxml-uhfffaoysa-n}}
+{{#set: inchi-key=inchikey=khpxuqmniqbqev-uhfffaoysa-l}}
-{{#set: molecular-weight=175.187}}
+{{#set: molecular-weight=130.057}}