Difference between revisions of "Peptides-with-Leader-Sequence"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite THIOCYSTEINE == * common-name: ** thiocysteine * smiles: ** c(ss)c(c([o-])=o)[n+] * inchi-key: ** xbkonscrebsmcs-reohclbhsa-n * molecular...") |
(Created page with "Category:metabolite == Metabolite L-ARGININO-SUCCINATE == * common-name: ** l-arginino-succinate * smiles: ** c(nc(=[n+])nc(cc(=o)[o-])c(=o)[o-])ccc(c(=o)[o-])[n+] * inchi...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-ARGININO-SUCCINATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-arginino-succinate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(nc(=[n+])nc(cc(=o)[o-])c(=o)[o-])ccc(c(=o)[o-])[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kdzoasgqnopscu-zbhicjrosa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 289.267 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ARGSUCCINLYA-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ARGSUCCINLYA-RXN]] |
| − | * [[RXN | + | * [[ARGSUCCINSYN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-arginino-succinate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kdzoasgqnopscu-zbhicjrosa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=289.267}} |
Revision as of 18:58, 14 January 2021
Contents
Metabolite L-ARGININO-SUCCINATE
- common-name:
- l-arginino-succinate
- smiles:
- c(nc(=[n+])nc(cc(=o)[o-])c(=o)[o-])ccc(c(=o)[o-])[n+]
- inchi-key:
- kdzoasgqnopscu-zbhicjrosa-m
- molecular-weight:
- 289.267
