Difference between revisions of "Peptides-with-Leader-Sequence"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-ARGININO-SUCCINATE == * common-name: ** l-arginino-succinate * smiles: ** c(nc(=[n+])nc(cc(=o)[o-])c(=o)[o-])ccc(c(=o)[o-])[n+] * inchi...") |
(Created page with "Category:metabolite == Metabolite L-1-GLYCERO-PHOSPHORYLCHOLINE == * common-name: ** sn-glycero-3-phosphocholine * smiles: ** c([n+](c)(c)c)cop([o-])(=o)occ(o)co * inchi-k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite L- | + | == Metabolite L-1-GLYCERO-PHOSPHORYLCHOLINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** sn-glycero-3-phosphocholine |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c([n+](c)(c)c)cop([o-])(=o)occ(o)co |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** suhoquvvvlnyqr-mrvpvssysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 257.223 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[LYSOPHOSPHOLIPASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=sn-glycero-3-phosphocholine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=suhoquvvvlnyqr-mrvpvssysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=257.223}} |
Revision as of 11:18, 15 January 2021
Contents
Metabolite L-1-GLYCERO-PHOSPHORYLCHOLINE
- common-name:
- sn-glycero-3-phosphocholine
- smiles:
- c([n+](c)(c)c)cop([o-])(=o)occ(o)co
- inchi-key:
- suhoquvvvlnyqr-mrvpvssysa-n
- molecular-weight:
- 257.223
