Difference between revisions of "Peptides-with-Leader-Sequence"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9666 RXN-9666] == * direction: ** left-to-right * common-name: ** palmitoyl-coa hydrolase * ec-...")
(Created page with "Category:metabolite == Metabolite 1-CHLORO-24-DINITROBENZENE == * common-name: ** 1-chloro-2,4-dinitrobenzene * smiles: ** c1(c=c(cl)c(=cc=1[n+]([o-])=o)[n+]([o-])=o) * in...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9666 RXN-9666] ==
+
== Metabolite 1-CHLORO-24-DINITROBENZENE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** palmitoyl-coa hydrolase
+
** 1-chloro-2,4-dinitrobenzene
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.1.2.2 ec-3.1.2.2]
+
** c1(c=c(cl)c(=cc=1[n+]([o-])=o)[n+]([o-])=o)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[OLEOYL-COA]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[OLEATE-CPD]][c] '''+''' 1 [[PROTON]][c]
+
** vyzahlcbvhpddf-uhfffaoysa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ09703]]
+
** 202.554
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[GST-RXN]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-321]], cutin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-321 PWY-321]
+
* [[GST-RXN]]
−
** '''3''' reactions found over '''16''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-5996]], oleate biosynthesis II (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5996 PWY-5996]
+
{{#set: common-name=1-chloro-2,4-dinitrobenzene}}
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=vyzahlcbvhpddf-uhfffaoysa-n}}
−
* [[PWY-1121]], suberin monomers biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-1121 PWY-1121]
+
{{#set: molecular-weight=202.554}}
−
** '''9''' reactions found over '''19''' reactions in the full pathway
 
−
* [[PWY-6733]], sporopollenin precursors biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6733 PWY-6733]
 
−
** '''8''' reactions found over '''18''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R08176 R08176]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=palmitoyl-coa hydrolase}}
 
−
{{#set: ec-number=ec-3.1.2.2}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=4}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite 1-CHLORO-24-DINITROBENZENE

  • common-name:
    • 1-chloro-2,4-dinitrobenzene
  • smiles:
    • c1(c=c(cl)c(=cc=1[n+]([o-])=o)[n+]([o-])=o)
  • inchi-key:
    • vyzahlcbvhpddf-uhfffaoysa-n
  • molecular-weight:
    • 202.554

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Peptides-with-Leader-Sequence&oldid=47922"