Difference between revisions of "Phenoxyl-rad-of-phenolic-donors"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17050 == * common-name: ** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine * smiles: ** c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)...")
(Created page with "Category:metabolite == Metabolite Phenoxyl-rad-of-phenolic-donors == * common-name: ** a phenoxyl radical of a phenolic donor == Reaction(s) known to consume the compound...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17050 ==
+
== Metabolite Phenoxyl-rad-of-phenolic-donors ==
 
* common-name:
 
* common-name:
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
+
** a phenoxyl radical of a phenolic donor
* smiles:
 
** c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)2)c(=o)n3)
 
* inchi-key:
 
** poiijaagmgnxlo-vxgbxaggsa-n
 
* molecular-weight:
 
** 296.358
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15684]]
+
* [[PEROXID-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=a phenoxyl radical of a phenolic donor}}
{{#set: inchi-key=inchikey=poiijaagmgnxlo-vxgbxaggsa-n}}
 
{{#set: molecular-weight=296.358}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite Phenoxyl-rad-of-phenolic-donors

  • common-name:
    • a phenoxyl radical of a phenolic donor

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality