Difference between revisions of "Phenoxyl-rad-of-phenolic-donors"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SUCL_LPAREN_gdp_RPAREN_m SUCL_LPAREN_gdp_RPAREN_m] == * direction: ** reversible * common-name: **...")
(Created page with "Category:metabolite == Metabolite CPD-17050 == * common-name: ** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine * smiles: ** c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=SUCL_LPAREN_gdp_RPAREN_m SUCL_LPAREN_gdp_RPAREN_m] ==
+
== Metabolite CPD-17050 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** succinyl-coa ligase (gdp-forming)
+
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[CO-A]][m] '''+''' 1.0 [[GTP]][m] '''+''' 1.0 [[SUC]][m] '''<=>''' 1.0 [[GDP]][m] '''+''' 1.0 [[Pi]][m] '''+''' 1.0 [[SUC-COA]][m]
+
** c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)2)c(=o)n3)
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ21782]]
+
** poiijaagmgnxlo-vxgbxaggsa-n
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 296.358
−
* Gene: [[SJ03269]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-15684]]
−
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
−
== Reconstruction information  ==
+
{{#set: common-name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine}}
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=poiijaagmgnxlo-vxgbxaggsa-n}}
−
== External links  ==
+
{{#set: molecular-weight=296.358}}
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=succinyl-coa ligase (gdp-forming)}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Revision as of 20:34, 18 December 2020

Metabolite CPD-17050

  • common-name:
    • 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
  • smiles:
    • c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)2)c(=o)n3)
  • inchi-key:
    • poiijaagmgnxlo-vxgbxaggsa-n
  • molecular-weight:
    • 296.358

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Phenoxyl-rad-of-phenolic-donors&oldid=47344"