Difference between revisions of "Phenyl-Acetates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-5-METHOXY-TRYPTAMINE == * common-name: ** melatonin * smiles: ** cc(=o)nccc2(=cnc1(=c(c=c(oc)c=c1)2)) * inchi-key: ** drlfmbdrbr...") |
(Created page with "Category:metabolite == Metabolite Phenyl-Acetates == * common-name: ** a phenyl acetate == Reaction(s) known to consume the compound == * ARYLESTERASE-RXN == Reaction(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Phenyl-Acetates == |
* common-name: | * common-name: | ||
| − | ** | + | ** a phenyl acetate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ARYLESTERASE-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a phenyl acetate}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite Phenyl-Acetates
- common-name:
- a phenyl acetate
