Difference between revisions of "Phosphatase-2A-leucine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15567 == * common-name: ** (3e)-tetradec-3-enoyl-coa * smiles: ** ccccccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(o...")
(Created page with "Category:metabolite == Metabolite FAD == * common-name: ** fad * smiles: ** cc6(=c(c)c=c5(c(n=c1(c(=o)[n-]c(=o)n=c1n(cc(c(o)c(o)cop(op([o-])(occ4(c(o)c(o)c(n3(c=nc2(c(n)=n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15567 ==
+
== Metabolite FAD ==
 
* common-name:
 
* common-name:
** (3e)-tetradec-3-enoyl-coa
+
** fad
 
* smiles:
 
* smiles:
** ccccccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** cc6(=c(c)c=c5(c(n=c1(c(=o)[n-]c(=o)n=c1n(cc(c(o)c(o)cop(op([o-])(occ4(c(o)c(o)c(n3(c=nc2(c(n)=nc=nc=23)))o4))=o)([o-])=o)o)5))=c6))
 
* inchi-key:
 
* inchi-key:
** ssocukxluzqjhu-ctfjfiklsa-j
+
** imgvnjnccgxbhd-uybvjogssa-k
 
* molecular-weight:
 
* molecular-weight:
** 971.845
+
** 782.533
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ACOA120OR]]
 +
* [[ACOA140OR]]
 +
* [[ACOA160OR]]
 +
* [[ACOA40OR]]
 +
* [[ACOA80OR]]
 +
* [[ACOAD1f]]
 +
* [[FAD-PYROPHOSPHATASE-RXN]]
 +
* [[IVCDH]]
 +
* [[MCDH]]
 +
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
 +
* [[PPCOAOm]]
 +
* [[RXN-11695]]
 +
* [[RXN-14264]]
 +
* [[SUCDHm]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14715]]
+
* [[ACOAD1f]]
 +
* [[FAD-PYROPHOSPHATASE-RXN]]
 +
* [[FADSYN-RXN]]
 +
* [[PPCOAOm]]
 +
* [[RXN-11695]]
 +
* [[RXN-14264]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3e)-tetradec-3-enoyl-coa}}
+
{{#set: common-name=fad}}
{{#set: inchi-key=inchikey=ssocukxluzqjhu-ctfjfiklsa-j}}
+
{{#set: inchi-key=inchikey=imgvnjnccgxbhd-uybvjogssa-k}}
{{#set: molecular-weight=971.845}}
+
{{#set: molecular-weight=782.533}}

Revision as of 15:29, 5 January 2021

Metabolite FAD

  • common-name:
    • fad
  • smiles:
    • cc6(=c(c)c=c5(c(n=c1(c(=o)[n-]c(=o)n=c1n(cc(c(o)c(o)cop(op([o-])(occ4(c(o)c(o)c(n3(c=nc2(c(n)=nc=nc=23)))o4))=o)([o-])=o)o)5))=c6))
  • inchi-key:
    • imgvnjnccgxbhd-uybvjogssa-k
  • molecular-weight:
    • 782.533

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality