Difference between revisions of "Phosphatase-2A-leucine-methyl-ester"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLUCOSAMINE-1P == * common-name: ** d-glucosamine 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c([n+])c(o)c(o)1) * inchi-key: ** y...")
(Created page with "Category:metabolite == Metabolite ARG-tRNAs == * common-name: ** a trnaarg == Reaction(s) known to consume the compound == * ARGININE--TRNA-LIGASE-RXN == Reaction(s) k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLUCOSAMINE-1P ==
+
== Metabolite ARG-tRNAs ==
 
* common-name:
 
* common-name:
** d-glucosamine 1-phosphate
+
** a trnaarg
* smiles:
 
** c(o)c1(oc(op(=o)([o-])[o-])c([n+])c(o)c(o)1)
 
* inchi-key:
 
** ymjbyrvfgyxulk-qzabapfnsa-m
 
* molecular-weight:
 
** 258.144
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.3.1.157-RXN]]
+
* [[ARGININE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ARGINYLTRANSFERASE-RXN]]
 +
* [[RXN-17888]]
 +
* [[RXN-17889]]
 +
* [[RXN-17890]]
 +
* [[RXN-17891]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-glucosamine 1-phosphate}}
+
{{#set: common-name=a trnaarg}}
{{#set: inchi-key=inchikey=ymjbyrvfgyxulk-qzabapfnsa-m}}
 
{{#set: molecular-weight=258.144}}
 

Revision as of 11:12, 15 January 2021

Metabolite ARG-tRNAs

  • common-name:
    • a trnaarg

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality