Difference between revisions of "Phosphoacetylglucosamine-Mutase"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE6PSYN-RXN TREHALOSE6PSYN-RXN] == * direction: ** left-to-right * common-name: ** trehalose...")
(Created page with "Category:metabolite == Metabolite 3OH-4P-OH-ALPHA-KETOBUTYRATE == * common-name: ** (3r)-3-hydroxy-2-oxo-4 phosphooxybutanoate * smiles: ** c(c(c(c([o-])=o)=o)o)op([o-])(=...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE6PSYN-RXN TREHALOSE6PSYN-RXN] ==
+
== Metabolite 3OH-4P-OH-ALPHA-KETOBUTYRATE ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** trehalose-6-phosphate synthase
+
** (3r)-3-hydroxy-2-oxo-4 phosphooxybutanoate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.4.1.15 ec-2.4.1.15]
+
** c(c(c(c([o-])=o)=o)o)op([o-])(=o)[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-12575]][c] '''+''' 1 [[D-glucopyranose-6-phosphate]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[TREHALOSE-6P]][c] '''+''' 1 [[UDP]][c]
+
** mzjfvxdtnbhtkz-uwtatzphsa-k
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** 211.045
* Gene: [[SJ13486]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
* [[PSERTRANSAMPYR-RXN]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
* Gene: [[SJ07303]]
+
* [[PSERTRANSAMPYR-RXN]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=(3r)-3-hydroxy-2-oxo-4 phosphooxybutanoate}}
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=mzjfvxdtnbhtkz-uwtatzphsa-k}}
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: molecular-weight=211.045}}
* Gene: [[SJ10128]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ17025]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ18387]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ18485]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ08873]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
</div>
 
== Pathway(s) ==
 
* [[TRESYN-PWY]], trehalose biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=TRESYN-PWY TRESYN-PWY]
 
** '''2''' reactions found over '''2''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18890 18890]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R00836 R00836]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P31677 P31677]
 
** [http://www.uniprot.org/uniprot/Q00764 Q00764]
 
** [http://www.uniprot.org/uniprot/P38427 P38427]
 
** [http://www.uniprot.org/uniprot/Q07158 Q07158]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=trehalose-6-phosphate synthase}}
 
{{#set: ec-number=ec-2.4.1.15}}
 
{{#set: nb gene associated=7}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite 3OH-4P-OH-ALPHA-KETOBUTYRATE

  • common-name:
    • (3r)-3-hydroxy-2-oxo-4 phosphooxybutanoate
  • smiles:
    • c(c(c(c([o-])=o)=o)o)op([o-])(=o)[o-]
  • inchi-key:
    • mzjfvxdtnbhtkz-uwtatzphsa-k
  • molecular-weight:
    • 211.045

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality