Difference between revisions of "Phospholipid-Cyclopropane-Fatty-Acids"

Revision as of 15:27, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite G-protein-coupled-receptors ==
+== Metabolite CPD-4209 ==
 * common-name:
-** a g protein-coupled receptor
+** n6-dimethylallyladenine
+* smiles:
+** cc(c)=ccnc1(=nc=nc2(nc=nc1=2))
+* inchi-key:
+** hyvabzigrdekcd-uhfffaoysa-n
+* molecular-weight:
+** 203.246
 == Reaction(s) known to consume the compound ==
-* [[2.7.11.16-RXN]]
+* [[1.5.99.12-RXN]]
+* [[RXN-4315]]
+* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
+* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 == Reaction(s) known to produce the compound ==
-* [[2.7.11.16-RXN]]
+* [[1.5.99.12-RXN]]
+* [[RXN-4313]]
+* [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]]
+* [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]]
+* [[RXN-4315]]
+* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
+* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=a g protein-coupled receptor}}
+{{#set: common-name=n6-dimethylallyladenine}}
+{{#set: inchi-key=inchikey=hyvabzigrdekcd-uhfffaoysa-n}}
+{{#set: molecular-weight=203.246}}