Difference between revisions of "Phospholipid-Cyclopropane-Fatty-Acids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4209 == * common-name: ** n6-dimethylallyladenine * smiles: ** cc(c)=ccnc1(=nc=nc2(nc=nc1=2)) * inchi-key: ** hyvabzigrdekcd-uhfffaoy...") |
(Created page with "Category:metabolite == Metabolite UDP-L-ARABINOSE == * common-name: ** udp-l-arabinose == Reaction(s) known to consume the compound == * UA4E == Reaction(s) known to p...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite UDP-L-ARABINOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** udp-l-arabinose |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[UA4E]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[UA4E]] |
| − | * [[ | + | * [[UMPU]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=udp-l-arabinose}} |
| − | |||
| − | |||
Revision as of 13:10, 14 January 2021
Contents
Metabolite UDP-L-ARABINOSE
- common-name:
- udp-l-arabinose
