Difference between revisions of "Phospholipid-Olefinic-Fatty-Acids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10717 RXN-10717] == * direction: ** left-to-right * common-name: ** indole acetaldehyde reducta...")
(Created page with "Category:metabolite == Metabolite CPD1F-4 == * common-name: ** (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al * smiles: ** cc(=cc=cc=c(c)...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10717 RXN-10717] ==
+
== Metabolite CPD1F-4 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** indole acetaldehyde reductase
+
** (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al
−
** alcohol dehydrogenase (nadp+)
+
* smiles:
−
* ec-number:
+
** cc(=cc=cc=c(c)c=o)c=cc=c(c)c=c=c1(c(o)(c)cc(o)cc(c)(c)1)
−
** [http://enzyme.expasy.org/EC/1.1.1.2 ec-1.1.1.2]
+
* inchi-key:
−
== Reaction formula ==
+
** mfdugtooxgorrx-orglzdqcsa-n
−
* 1 [[INDOLE_ACETALDEHYDE]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-341]][c] '''+''' 1 [[NADP]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 382.542
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to consume the compound ==
−
* Gene: [[SJ13034]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-698]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ05644]]
+
{{#set: common-name=(3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-&beta;-caroten-12'-al}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=mfdugtooxgorrx-orglzdqcsa-n}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: molecular-weight=382.542}}
−
* Gene: [[SJ12574]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ06456]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ10501]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ19151]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ07103]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ06470]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
</div>
 
−
== Pathway(s) ==
 
−
* [[PWY-6307]], L-tryptophan degradation X (mammalian, via tryptamine): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6307 PWY-6307]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=indole acetaldehyde reductase|alcohol dehydrogenase (nadp+)}}
 
−
{{#set: ec-number=ec-1.1.1.2}}
 
−
{{#set: nb gene associated=8}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:38, 18 December 2020

Metabolite CPD1F-4

  • common-name:
    • (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al
  • smiles:
    • cc(=cc=cc=c(c)c=o)c=cc=c(c)c=c=c1(c(o)(c)cc(o)cc(c)(c)1)
  • inchi-key:
    • mfdugtooxgorrx-orglzdqcsa-n
  • molecular-weight:
    • 382.542

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Phospholipid-Olefinic-Fatty-Acids&oldid=48651"