Difference between revisions of "Phospholipid-Olefinic-Fatty-Acids"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10717 RXN-10717] == * direction: ** left-to-right * common-name: ** indole acetaldehyde reducta...") |
(Created page with "Category:metabolite == Metabolite CPD1F-4 == * common-name: ** (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al * smiles: ** cc(=cc=cc=c(c)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD1F-4 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al |
− | + | * smiles: | |
− | * | + | ** cc(=cc=cc=c(c)c=o)c=cc=c(c)c=c=c1(c(o)(c)cc(o)cc(c)(c)1) |
− | ** | + | * inchi-key: |
− | + | ** mfdugtooxgorrx-orglzdqcsa-n | |
− | + | * molecular-weight: | |
− | == | + | ** 382.542 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-698]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=(3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al}} | |
− | + | {{#set: inchi-key=inchikey=mfdugtooxgorrx-orglzdqcsa-n}} | |
− | + | {{#set: molecular-weight=382.542}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | * | ||
− | == | ||
− | |||
− | {{#set: common-name= | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− |
Revision as of 20:38, 18 December 2020
Contents
Metabolite CPD1F-4
- common-name:
- (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al
- smiles:
- cc(=cc=cc=c(c)c=o)c=cc=c(c)c=c=c1(c(o)(c)cc(o)cc(c)(c)1)
- inchi-key:
- mfdugtooxgorrx-orglzdqcsa-n
- molecular-weight:
- 382.542