Difference between revisions of "Phosphorylated-phosphoglucomutase"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-520 == * common-name: ** quercetin * smiles: ** c1(c=c(o)c(o)=cc=1c2(oc3(=c(c(=o)c=2[o-])c(o)=cc(o)=c3))) * inchi-key: ** refjwtpedvj...")
(Created page with "Category:metabolite == Metabolite Phosphorylated-phosphoglucomutase == * common-name: ** a phosphorylated phosphoglucomutase == Reaction(s) known to consume the compound =...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-520 ==
+
== Metabolite Phosphorylated-phosphoglucomutase ==
 
* common-name:
 
* common-name:
** quercetin
+
** a phosphorylated phosphoglucomutase
* smiles:
 
** c1(c=c(o)c(o)=cc=1c2(oc3(=c(c(=o)c=2[o-])c(o)=cc(o)=c3)))
 
* inchi-key:
 
** refjwtpedvjjiy-uhfffaoysa-m
 
* molecular-weight:
 
** 301.232
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[QUERCETIN-23-DIOXYGENASE-RXN]]
+
* [[RXN-16997]]
* [[QUERCETIN-3-O-METHYLTRANSFERASE-RXN]]
 
* [[RXN1F-462]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12510]]
+
* [[RXN-16998]]
* [[RXN-527]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=quercetin}}
+
{{#set: common-name=a phosphorylated phosphoglucomutase}}
{{#set: inchi-key=inchikey=refjwtpedvjjiy-uhfffaoysa-m}}
 
{{#set: molecular-weight=301.232}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Phosphorylated-phosphoglucomutase

  • common-name:
    • a phosphorylated phosphoglucomutase

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality