Difference between revisions of "Phosphorylated-receptor-proteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ISOBUTANOL == * common-name: ** isobutanol * smiles: ** cc(c)co * inchi-key: ** zxekiibdnhejcq-uhfffaoysa-n * molecular-weight: ** 74.122...") |
(Created page with "Category:metabolite == Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE == * common-name: ** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate * smiles: ** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate |
* smiles: | * smiles: | ||
− | ** cc(c) | + | ** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])=o)(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** rqmcndrmpzbeod-uhfffaoysa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 217.112 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-2464]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-2464]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-hydroxy-4-oxobutane-1,2,4-tricarboxylate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rqmcndrmpzbeod-uhfffaoysa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=217.112}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE
- common-name:
- 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
- smiles:
- c(c(cc(o)(cc(=o)[o-])c(=o)[o-])=o)(=o)[o-]
- inchi-key:
- rqmcndrmpzbeod-uhfffaoysa-k
- molecular-weight:
- 217.112