Difference between revisions of "Phosphoserines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1G-1344 == * common-name: ** α, α'-trehalose 6-α-mycolate * smiles: ** ccccccccccccccccccccccccccc(c(o)ccccccccccccc...")
(Created page with "Category:metabolite == Metabolite BENZOYLCOA == * common-name: ** benzoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1G-1344 ==
+
== Metabolite BENZOYLCOA ==
 
* common-name:
 
* common-name:
** α, α'-trehalose 6-α-mycolate
+
** benzoyl-coa
 
* smiles:
 
* smiles:
** ccccccccccccccccccccccccccc(c(o)cccccccccccccccc2(cc(ccccccccccc1(cc(cccccccccccccccccc)1))2))c(=o)occ3(oc(c(c(c3o)o)o)oc4(c(c(c(c(o4)co)o)o)o))
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** haspjlrxbagtid-bgzciimlsa-n
+
** vevjtunlalkrno-tyhxjlicsa-j
 
* molecular-weight:
 
* molecular-weight:
** 1462.341
+
** 867.61
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1G-1435]]
+
* [[RXN-2006]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α, α'-trehalose 6-α-mycolate}}
+
{{#set: common-name=benzoyl-coa}}
{{#set: inchi-key=inchikey=haspjlrxbagtid-bgzciimlsa-n}}
+
{{#set: inchi-key=inchikey=vevjtunlalkrno-tyhxjlicsa-j}}
{{#set: molecular-weight=1462.341}}
+
{{#set: molecular-weight=867.61}}

Revision as of 14:57, 5 January 2021

Metabolite BENZOYLCOA

  • common-name:
    • benzoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • vevjtunlalkrno-tyhxjlicsa-j
  • molecular-weight:
    • 867.61

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality