Difference between revisions of "Phosphoserines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite VAL == * common-name: ** l-valine * smiles: ** cc(c)c([n+])c([o-])=o * inchi-key: ** kzsnjwfqevhdmf-bypyzucnsa-n * molecular-weight: ** 1...")
(Created page with "Category:metabolite == Metabolite CPD-9871 == * common-name: ** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite VAL ==
+
== Metabolite CPD-9871 ==
 
* common-name:
 
* common-name:
** l-valine
+
** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol
 
* smiles:
 
* smiles:
** cc(c)c([n+])c([o-])=o
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** kzsnjwfqevhdmf-bypyzucnsa-n
+
** xcoxsblqzpfvgk-rgiwonjesa-n
 
* molecular-weight:
 
* molecular-weight:
** 117.147
+
** 835.347
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
 
* [[RXN-16291]]
 
* [[RXN-16294]]
 
* [[RXN-16991]]
 
* [[VALINE--TRNA-LIGASE-RXN]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
+
* [[RXN-9235]]
* [[RXN-16294]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-valine}}
+
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol}}
{{#set: inchi-key=inchikey=kzsnjwfqevhdmf-bypyzucnsa-n}}
+
{{#set: inchi-key=inchikey=xcoxsblqzpfvgk-rgiwonjesa-n}}
{{#set: molecular-weight=117.147}}
+
{{#set: molecular-weight=835.347}}

Revision as of 13:10, 14 January 2021

Metabolite CPD-9871

  • common-name:
    • 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c)c
  • inchi-key:
    • xcoxsblqzpfvgk-rgiwonjesa-n
  • molecular-weight:
    • 835.347

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality