Difference between revisions of "Plasmanylcholine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-aspartyl-tRNAAsn == * common-name: ** an l-aspartyl-[trnaasn] == Reaction(s) known to consume the compound == * 6.3.5.6-RXN == Reac...") |
(Created page with "Category:metabolite == Metabolite CPD-15301 == * common-name: ** caldariellaquinol * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2))...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15301 == |
* common-name: | * common-name: | ||
| − | ** | + | ** caldariellaquinol |
| + | * smiles: | ||
| + | ** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2)) | ||
| + | * inchi-key: | ||
| + | ** uvcqokdzgiahdg-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 633.085 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-15378]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=caldariellaquinol}} |
| + | {{#set: inchi-key=inchikey=uvcqokdzgiahdg-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=633.085}} | ||
Revision as of 08:26, 15 March 2021
Contents
Metabolite CPD-15301
- common-name:
- caldariellaquinol
- smiles:
- cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2))
- inchi-key:
- uvcqokdzgiahdg-uhfffaoysa-n
- molecular-weight:
- 633.085
