Difference between revisions of "Plasmanylcholine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TAGATOSE-1-6-DIPHOSPHATE == * common-name: ** d-tagatofuranose 1,6-bisphosphate * smiles: ** c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=...")
(Created page with "Category:metabolite == Metabolite Plasmanylcholine == * common-name: ** a plasmanylcholine == Reaction(s) known to consume the compound == == Reaction(s) known to produce...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TAGATOSE-1-6-DIPHOSPHATE ==
+
== Metabolite Plasmanylcholine ==
 
* common-name:
 
* common-name:
** d-tagatofuranose 1,6-bisphosphate
+
** a plasmanylcholine
* smiles:
 
** c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=o)c(o)c1o)
 
* inchi-key:
 
** rnbgygvwrkecfj-oexcpvawsa-j
 
* molecular-weight:
 
** 336.085
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TAGAALDOL-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[TAGAKIN-RXN]]
+
* [[RXN-17733]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-tagatofuranose 1,6-bisphosphate}}
+
{{#set: common-name=a plasmanylcholine}}
{{#set: inchi-key=inchikey=rnbgygvwrkecfj-oexcpvawsa-j}}
 
{{#set: molecular-weight=336.085}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Plasmanylcholine

  • common-name:
    • a plasmanylcholine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality