Difference between revisions of "Plastoquinols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1103 == * common-name: ** taxiphyllin * smiles: ** c1(c=c(o)c=cc=1c(oc2(oc(co)c(o)c(o)c(o)2))c#n) * inchi-key: ** nvltyojhpbmilu-gmdx...") |
(Created page with "Category:metabolite == Metabolite Plastoquinols == * common-name: ** a plastoquinol == Reaction(s) known to consume the compound == * RXN-12303 == Reaction(s) known to...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Plastoquinols == |
* common-name: | * common-name: | ||
| − | ** | + | ** a plastoquinol |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12303]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[PSII-RXN]] | ||
| + | * [[RXN-11355]] | ||
| + | * [[RXN-12243]] | ||
| + | * [[RXN-12244]] | ||
| + | * [[RXN-12303]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a plastoquinol}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Plastoquinols
- common-name:
- a plastoquinol
