Difference between revisions of "Poly-Gamma-Glutamylcysteine-Glycines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-374 == * common-name: ** sepiapterin * smiles: ** cc(o)c(=o)c1(cnc2(n=c(n)nc(=o)c(n=1)=2)) * inchi-key: ** vpvoxuspxfpwbn-vkhmyheasa-...") |
(Created page with "Category:metabolite == Metabolite Poly-Gamma-Glutamylcysteine-Glycines == * common-name: ** a poly-[γ-glutamylcysteine]-glycine == Reaction(s) known to consume the c...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Poly-Gamma-Glutamylcysteine-Glycines == |
* common-name: | * common-name: | ||
| − | ** | + | ** a poly-[γ-glutamylcysteine]-glycine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.3.2.15-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.3.2.15-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a poly-[γ-glutamylcysteine]-glycine}} |
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite Poly-Gamma-Glutamylcysteine-Glycines
- common-name:
- a poly-[γ-glutamylcysteine]-glycine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a poly-[γ-glutamylcysteine]-glycine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
